C17H12Cl4N4O3S — CID 16546937
2-[4-(3,4,5,6-tetrachloropyridine-2-carbonyl)piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 16546937) has the molecular formula C17H12Cl4N4O3S and a molecular weight of 494.19 g/mol. Its IUPAC name is 2-[4-(3,4,5,6-tetrachloropyridine-2-carbonyl)piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-(3,4,5,6-tetrachloropyridine-2-carbonyl)piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 16546937 |
| Molecular Formula | C17H12Cl4N4O3S |
| Molecular Weight | 494.19 g/mol |
| Exact Mass | 491.94 |
| IUPAC Name | 2-[4-(3,4,5,6-tetrachloropyridine-2-carbonyl)piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCN(C(=O)c2nc(Cl)c(Cl)c(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C17H12Cl4N4O3S/c18-12-13(19)15(23-16(21)14(12)20)17(26)24-5-7-25(8-6-24)29(27,28)11-4-2-1-3-10(11)9-22/h1-4H,5-8H2 |
| InChIKey | RMRGAMLCNYFUPV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 94.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.19 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|