C16H17Cl2N3O3S — CID 30879579
2-[4-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 30879579) has the molecular formula C16H17Cl2N3O3S and a molecular weight of 402.30 g/mol. Its IUPAC name is 2-[4-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 30879579 |
| Molecular Formula | C16H17Cl2N3O3S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 2-[4-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | C[C@]1(C(=O)N2CCN(S(=O)(=O)c3ccccc3C#N)CC2)CC1(Cl)Cl |
| InChI | InChI=1S/C16H17Cl2N3O3S/c1-15(11-16(15,17)18)14(22)20-6-8-21(9-7-20)25(23,24)13-5-3-2-4-12(13)10-19/h2-5H,6-9,11H2,1H3/t15-/m1/s1 |
| InChIKey | WFOZTHPRLFDNHL-OAHLLOKOSA-N |
| XLogP | 1.98 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|