C17H21N3O5S — CID 9089473
ethyl 4-[4-(2-cyanophenyl)sulfonylpiperazin-1-yl]-4-oxobutanoate (PubChem CID 9089473) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is ethyl 4-[4-(2-cyanophenyl)sulfonylpiperazin-1-yl]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-(2-cyanophenyl)sulfonylpiperazin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 9089473 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | ethyl 4-[4-(2-cyanophenyl)sulfonylpiperazin-1-yl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N1CCN(S(=O)(=O)c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C17H21N3O5S/c1-2-25-17(22)8-7-16(21)19-9-11-20(12-10-19)26(23,24)15-6-4-3-5-14(15)13-18/h3-6H,2,7-12H2,1H3 |
| InChIKey | HLVMQGQXIBXTMK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 107.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |