C17H18N4O3S — CID 110805398
2-[4-(1-methylpyrrole-3-carbonyl)piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 110805398) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-[4-(1-methylpyrrole-3-carbonyl)piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-(1-methylpyrrole-3-carbonyl)piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 110805398 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-[4-(1-methylpyrrole-3-carbonyl)piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | Cn1ccc(C(=O)N2CCN(S(=O)(=O)c3ccccc3C#N)CC2)c1 |
| InChI | InChI=1S/C17H18N4O3S/c1-19-7-6-15(13-19)17(22)20-8-10-21(11-9-20)25(23,24)16-5-3-2-4-14(16)12-18/h2-7,13H,8-11H2,1H3 |
| InChIKey | AJICWWBOEHEYAF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 86.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |