C20H15F6N3O3S — CID 26898983
2-[4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 26898983) has the molecular formula C20H15F6N3O3S and a molecular weight of 491.41 g/mol. Its IUPAC name is 2-[4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 26898983 |
| Molecular Formula | C20H15F6N3O3S |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | 2-[4-[3,5-bis(trifluoromethyl)benzoyl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCN(C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H15F6N3O3S/c21-19(22,23)15-9-14(10-16(11-15)20(24,25)26)18(30)28-5-7-29(8-6-28)33(31,32)17-4-2-1-3-13(17)12-27/h1-4,9-11H,5-8H2 |
| InChIKey | PCKGLYYXXNCOHH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |