C18H16F3N3O4S2 — CID 24678225
2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]sulfonylbenzonitrile (PubChem CID 24678225) has the molecular formula C18H16F3N3O4S2 and a molecular weight of 459.47 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 24678225 |
| Molecular Formula | C18H16F3N3O4S2 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | 2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H16F3N3O4S2/c19-18(20,21)15-5-7-16(8-6-15)29(25,26)23-9-11-24(12-10-23)30(27,28)17-4-2-1-3-14(17)13-22/h1-8H,9-12H2 |
| InChIKey | QJEDGHVNFIZOSA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |