C20H18F6N2O3S — CID 27757367
(4-benzylsulfonylpiperazin-1-yl)-[3,5-bis(trifluoromethyl)phenyl]methanone (PubChem CID 27757367) has the molecular formula C20H18F6N2O3S and a molecular weight of 480.43 g/mol. Its IUPAC name is (4-benzylsulfonylpiperazin-1-yl)-[3,5-bis(trifluoromethyl)phenyl]methanone.
| Compound Name | (4-benzylsulfonylpiperazin-1-yl)-[3,5-bis(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 27757367 |
| Molecular Formula | C20H18F6N2O3S |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | (4-benzylsulfonylpiperazin-1-yl)-[3,5-bis(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H18F6N2O3S/c21-19(22,23)16-10-15(11-17(12-16)20(24,25)26)18(29)27-6-8-28(9-7-27)32(30,31)13-14-4-2-1-3-5-14/h1-5,10-12H,6-9,13H2 |
| InChIKey | JYGDVZLRWDVJTM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |