C18H21N3O3S — CID 110798876
(4-benzylsulfonyl-1,4-diazepan-1-yl)-pyridin-3-ylmethanone (PubChem CID 110798876) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is (4-benzylsulfonyl-1,4-diazepan-1-yl)-pyridin-3-ylmethanone.
| Compound Name | (4-benzylsulfonyl-1,4-diazepan-1-yl)-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 110798876 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (4-benzylsulfonyl-1,4-diazepan-1-yl)-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H21N3O3S/c22-18(17-8-4-9-19-14-17)20-10-5-11-21(13-12-20)25(23,24)15-16-6-2-1-3-7-16/h1-4,6-9,14H,5,10-13,15H2 |
| InChIKey | HFOHQYBESHACSF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |