C17H26N2O3S — CID 110797784
1-(4-benzylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one (PubChem CID 110797784) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 1-(4-benzylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(4-benzylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 110797784 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-(4-benzylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CCCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H26N2O3S/c1-17(2,3)16(20)18-10-7-11-19(13-12-18)23(21,22)14-15-8-5-4-6-9-15/h4-6,8-9H,7,10-14H2,1-3H3 |
| InChIKey | YBKCORRJGIGCAY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |