C16H24N2O3S — CID 110797764
1-[4-(benzenesulfonyl)-1,4-diazepan-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 110797764) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)-1,4-diazepan-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-(benzenesulfonyl)-1,4-diazepan-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 110797764 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-[4-(benzenesulfonyl)-1,4-diazepan-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CCCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H24N2O3S/c1-16(2,3)15(19)17-10-7-11-18(13-12-17)22(20,21)14-8-5-4-6-9-14/h4-6,8-9H,7,10-13H2,1-3H3 |
| InChIKey | NVCYKPVINXYPAF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |