C13H18N2O4S — CID 60575119
methyl 4-(benzenesulfonyl)-1,4-diazepane-1-carboxylate (PubChem CID 60575119) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is methyl 4-(benzenesulfonyl)-1,4-diazepane-1-carboxylate.
| Compound Name | methyl 4-(benzenesulfonyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 60575119 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | methyl 4-(benzenesulfonyl)-1,4-diazepane-1-carboxylate |
| SMILES | COC(=O)N1CCCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C13H18N2O4S/c1-19-13(16)14-8-5-9-15(11-10-14)20(17,18)12-6-3-2-4-7-12/h2-4,6-7H,5,8-11H2,1H3 |
| InChIKey | SYCGSJNHPCNYPL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |