C16H24N2O6S — CID 110799109
methyl 4-[4-(2-methoxyethoxy)phenyl]sulfonyl-1,4-diazepane-1-carboxylate (PubChem CID 110799109) has the molecular formula C16H24N2O6S and a molecular weight of 372.44 g/mol. Its IUPAC name is methyl 4-[4-(2-methoxyethoxy)phenyl]sulfonyl-1,4-diazepane-1-carboxylate.
| Compound Name | methyl 4-[4-(2-methoxyethoxy)phenyl]sulfonyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 110799109 |
| Molecular Formula | C16H24N2O6S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | methyl 4-[4-(2-methoxyethoxy)phenyl]sulfonyl-1,4-diazepane-1-carboxylate |
| SMILES | COCCOc1ccc(S(=O)(=O)N2CCCN(C(=O)OC)CC2)cc1 |
| InChI | InChI=1S/C16H24N2O6S/c1-22-12-13-24-14-4-6-15(7-5-14)25(20,21)18-9-3-8-17(10-11-18)16(19)23-2/h4-7H,3,8-13H2,1-2H3 |
| InChIKey | JZOQWMSQSOZJPX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|