C16H20Cl2N2O3S — CID 32647739
(4-benzylsulfonylpiperazin-1-yl)-[(1S)-2,2-dichloro-1-methylcyclopropyl]methanone (PubChem CID 32647739) has the molecular formula C16H20Cl2N2O3S and a molecular weight of 391.32 g/mol. Its IUPAC name is (4-benzylsulfonylpiperazin-1-yl)-[(1S)-2,2-dichloro-1-methylcyclopropyl]methanone.
| Compound Name | (4-benzylsulfonylpiperazin-1-yl)-[(1S)-2,2-dichloro-1-methylcyclopropyl]methanone |
|---|---|
| PubChem CID | 32647739 |
| Molecular Formula | C16H20Cl2N2O3S |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | (4-benzylsulfonylpiperazin-1-yl)-[(1S)-2,2-dichloro-1-methylcyclopropyl]methanone |
| SMILES | C[C@@]1(C(=O)N2CCN(S(=O)(=O)Cc3ccccc3)CC2)CC1(Cl)Cl |
| InChI | InChI=1S/C16H20Cl2N2O3S/c1-15(12-16(15,17)18)14(21)19-7-9-20(10-8-19)24(22,23)11-13-5-3-2-4-6-13/h2-6H,7-12H2,1H3/t15-/m0/s1 |
| InChIKey | HVGFLGMHPZGXFX-HNNXBMFYSA-N |
| XLogP | 2.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|