C14H19ClN2O3S — CID 156907199
1-(4-benzylsulfonyl-1,4-diazepan-1-yl)-2-chloroethanone (PubChem CID 156907199) has the molecular formula C14H19ClN2O3S and a molecular weight of 330.84 g/mol. Its IUPAC name is 1-(4-benzylsulfonyl-1,4-diazepan-1-yl)-2-chloroethanone.
| Compound Name | 1-(4-benzylsulfonyl-1,4-diazepan-1-yl)-2-chloroethanone |
|---|---|
| PubChem CID | 156907199 |
| Molecular Formula | C14H19ClN2O3S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-(4-benzylsulfonyl-1,4-diazepan-1-yl)-2-chloroethanone |
| SMILES | O=C(CCl)N1CCCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C14H19ClN2O3S/c15-11-14(18)16-7-4-8-17(10-9-16)21(19,20)12-13-5-2-1-3-6-13/h1-3,5-6H,4,7-12H2 |
| InChIKey | DEPIHNLTFXPDAF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|