C31H40ClN3O6S3 — CID 140984161
1,5,9-tris(benzylsulfonyl)-3-(chloromethyl)-1,5,9-triazacyclododecane (PubChem CID 140984161) has the molecular formula C31H40ClN3O6S3 and a molecular weight of 682.33 g/mol. Its IUPAC name is 1,5,9-tris(benzylsulfonyl)-3-(chloromethyl)-1,5,9-triazacyclododecane.
| Compound Name | 1,5,9-tris(benzylsulfonyl)-3-(chloromethyl)-1,5,9-triazacyclododecane |
|---|---|
| PubChem CID | 140984161 |
| Molecular Formula | C31H40ClN3O6S3 |
| Molecular Weight | 682.33 g/mol |
| Exact Mass | 681.18 |
| IUPAC Name | 1,5,9-tris(benzylsulfonyl)-3-(chloromethyl)-1,5,9-triazacyclododecane |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCCN(S(=O)(=O)Cc2ccccc2)CC(CCl)CN(S(=O)(=O)Cc2ccccc2)CCC1 |
| InChI | InChI=1S/C31H40ClN3O6S3/c32-22-31-23-34(43(38,39)26-29-14-6-2-7-15-29)20-10-18-33(42(36,37)25-28-12-4-1-5-13-28)19-11-21-35(24-31)44(40,41)27-30-16-8-3-9-17-30/h1-9,12-17,31H,10-11,18-27H2 |
| InChIKey | AOBBMXILTWXCOJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|