C12H17NO3S — CID 92966032
(3S)-1-benzylsulfonylpiperidin-3-ol (PubChem CID 92966032) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is (3S)-1-benzylsulfonylpiperidin-3-ol.
| Compound Name | (3S)-1-benzylsulfonylpiperidin-3-ol |
|---|---|
| PubChem CID | 92966032 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (3S)-1-benzylsulfonylpiperidin-3-ol |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C12H17NO3S/c14-12-7-4-8-13(9-12)17(15,16)10-11-5-2-1-3-6-11/h1-3,5-6,12,14H,4,7-10H2/t12-/m0/s1 |
| InChIKey | HYJBASSVRMHRTG-LBPRGKRZSA-N |
| XLogP | 0.97 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |