C14H21NO3S — CID 107225038
(3S)-1-(2-phenylpropylsulfonyl)piperidin-3-ol (PubChem CID 107225038) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is (3S)-1-(2-phenylpropylsulfonyl)piperidin-3-ol.
| Compound Name | (3S)-1-(2-phenylpropylsulfonyl)piperidin-3-ol |
|---|---|
| PubChem CID | 107225038 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (3S)-1-(2-phenylpropylsulfonyl)piperidin-3-ol |
| SMILES | CC(CS(=O)(=O)N1CCC[C@H](O)C1)c1ccccc1 |
| InChI | InChI=1S/C14H21NO3S/c1-12(13-6-3-2-4-7-13)11-19(17,18)15-9-5-8-14(16)10-15/h2-4,6-7,12,14,16H,5,8-11H2,1H3/t12?,14-/m0/s1 |
| InChIKey | IRIBZABFBBLSSP-PYMCNQPYSA-N |
| XLogP | 1.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |