C31H39N3O6S3 — CID 140984157
1,5,9-tris(benzylsulfonyl)-3-methylidene-1,5,9-triazacyclododecane (PubChem CID 140984157) has the molecular formula C31H39N3O6S3 and a molecular weight of 645.87 g/mol. Its IUPAC name is 1,5,9-tris(benzylsulfonyl)-3-methylidene-1,5,9-triazacyclododecane.
| Compound Name | 1,5,9-tris(benzylsulfonyl)-3-methylidene-1,5,9-triazacyclododecane |
|---|---|
| PubChem CID | 140984157 |
| Molecular Formula | C31H39N3O6S3 |
| Molecular Weight | 645.87 g/mol |
| Exact Mass | 645.20 |
| IUPAC Name | 1,5,9-tris(benzylsulfonyl)-3-methylidene-1,5,9-triazacyclododecane |
| SMILES | C=C1CN(S(=O)(=O)Cc2ccccc2)CCCN(S(=O)(=O)Cc2ccccc2)CCCN(S(=O)(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C31H39N3O6S3/c1-28-23-33(42(37,38)26-30-15-7-3-8-16-30)21-11-19-32(41(35,36)25-29-13-5-2-6-14-29)20-12-22-34(24-28)43(39,40)27-31-17-9-4-10-18-31/h2-10,13-18H,1,11-12,19-27H2 |
| InChIKey | STLYKEZIPGZZFY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.87 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|