C18H23N3O3S — CID 110810521
1-(4-benzylsulfonyl-1,4-diazepan-1-yl)-2-(1H-pyrrol-2-yl)ethanone (PubChem CID 110810521) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 1-(4-benzylsulfonyl-1,4-diazepan-1-yl)-2-(1H-pyrrol-2-yl)ethanone.
| Compound Name | 1-(4-benzylsulfonyl-1,4-diazepan-1-yl)-2-(1H-pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 110810521 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 1-(4-benzylsulfonyl-1,4-diazepan-1-yl)-2-(1H-pyrrol-2-yl)ethanone |
| SMILES | O=C(Cc1ccc[nH]1)N1CCCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H23N3O3S/c22-18(14-17-8-4-9-19-17)20-10-5-11-21(13-12-20)25(23,24)15-16-6-2-1-3-7-16/h1-4,6-9,19H,5,10-15H2 |
| InChIKey | OBYKJLRAWDZEAE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |