C20H17F6NO — CID 44765726
[3,5-bis(trifluoromethyl)phenyl]-(4-phenylpiperidin-1-yl)methanone (PubChem CID 44765726) has the molecular formula C20H17F6NO and a molecular weight of 401.35 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-(4-phenylpiperidin-1-yl)methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-(4-phenylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 44765726 |
| Molecular Formula | C20H17F6NO |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-(4-phenylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H17F6NO/c21-19(22,23)16-10-15(11-17(12-16)20(24,25)26)18(28)27-8-6-14(7-9-27)13-4-2-1-3-5-13/h1-5,10-12,14H,6-9H2 |
| InChIKey | AVTKOVGLYPWBJG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |