C26H29F3N2O2 — CID 55594757
N-(4-phenylcyclohexyl)-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide (PubChem CID 55594757) has the molecular formula C26H29F3N2O2 and a molecular weight of 458.52 g/mol. Its IUPAC name is N-(4-phenylcyclohexyl)-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide.
| Compound Name | N-(4-phenylcyclohexyl)-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55594757 |
| Molecular Formula | C26H29F3N2O2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | N-(4-phenylcyclohexyl)-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide |
| SMILES | O=C(NC1CCC(c2ccccc2)CC1)C1CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C26H29F3N2O2/c27-26(28,29)22-10-6-21(7-11-22)25(33)31-16-14-20(15-17-31)24(32)30-23-12-8-19(9-13-23)18-4-2-1-3-5-18/h1-7,10-11,19-20,23H,8-9,12-17H2,(H,30,32) |
| InChIKey | LKGJSDZNIVWJLP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |