C19H16F6N2O — CID 42705379
[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]-phenylmethanone (PubChem CID 42705379) has the molecular formula C19H16F6N2O and a molecular weight of 402.34 g/mol. Its IUPAC name is [4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 42705379 |
| Molecular Formula | C19H16F6N2O |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCN(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H16F6N2O/c20-18(21,22)14-10-15(19(23,24)25)12-16(11-14)26-6-8-27(9-7-26)17(28)13-4-2-1-3-5-13/h1-5,10-12H,6-9H2 |
| InChIKey | GTSCZGUXXPXMQF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |