C17H16F3N3O — CID 9048304
(4-pyridin-4-ylpiperazin-1-yl)-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 9048304) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is (4-pyridin-4-ylpiperazin-1-yl)-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | (4-pyridin-4-ylpiperazin-1-yl)-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 9048304 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (4-pyridin-4-ylpiperazin-1-yl)-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C17H16F3N3O/c18-17(19,20)14-3-1-2-13(12-14)16(24)23-10-8-22(9-11-23)15-4-6-21-7-5-15/h1-7,12H,8-11H2 |
| InChIKey | NUMMLUHBHDHIFF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |