C24H22F6N2O2 — CID 10163079
1-[1-[3,5-bis(trifluoromethyl)benzoyl]-3-phenylpiperidin-4-yl]pyrrolidin-3-one (PubChem CID 10163079) has the molecular formula C24H22F6N2O2 and a molecular weight of 484.44 g/mol. Its IUPAC name is 1-[1-[3,5-bis(trifluoromethyl)benzoyl]-3-phenylpiperidin-4-yl]pyrrolidin-3-one.
| Compound Name | 1-[1-[3,5-bis(trifluoromethyl)benzoyl]-3-phenylpiperidin-4-yl]pyrrolidin-3-one |
|---|---|
| PubChem CID | 10163079 |
| Molecular Formula | C24H22F6N2O2 |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 1-[1-[3,5-bis(trifluoromethyl)benzoyl]-3-phenylpiperidin-4-yl]pyrrolidin-3-one |
| SMILES | O=C1CCN(C2CCN(C(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2c2ccccc2)C1 |
| InChI | InChI=1S/C24H22F6N2O2/c25-23(26,27)17-10-16(11-18(12-17)24(28,29)30)22(34)32-9-7-21(31-8-6-19(33)13-31)20(14-32)15-4-2-1-3-5-15/h1-5,10-12,20-21H,6-9,13-14H2 |
| InChIKey | PFQVGWLVKBANFL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |