C30H28F6N2O2 — CID 87992886
[3,5-bis(trifluoromethyl)phenyl]-[(3S,4R)-3-(4-morpholin-4-ylphenyl)-4-phenylpiperidin-1-yl]methanone (PubChem CID 87992886) has the molecular formula C30H28F6N2O2 and a molecular weight of 562.55 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[(3S,4R)-3-(4-morpholin-4-ylphenyl)-4-phenylpiperidin-1-yl]methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[(3S,4R)-3-(4-morpholin-4-ylphenyl)-4-phenylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 87992886 |
| Molecular Formula | C30H28F6N2O2 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[(3S,4R)-3-(4-morpholin-4-ylphenyl)-4-phenylpiperidin-1-yl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CC[C@@H](c2ccccc2)[C@@H](c2ccc(N3CCOCC3)cc2)C1 |
| InChI | InChI=1S/C30H28F6N2O2/c31-29(32,33)23-16-22(17-24(18-23)30(34,35)36)28(39)38-11-10-26(20-4-2-1-3-5-20)27(19-38)21-6-8-25(9-7-21)37-12-14-40-15-13-37/h1-9,16-18,26-27H,10-15,19H2/t26-,27+/m0/s1 |
| InChIKey | SYYHXOCRLXLPOB-RRPNLBNLSA-N |
| XLogP | 6.97 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|