C23H28N2O2 — CID 129355029
(4-morpholin-4-ylphenyl)-[(3S)-3-phenylazepan-1-yl]methanone (PubChem CID 129355029) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (4-morpholin-4-ylphenyl)-[(3S)-3-phenylazepan-1-yl]methanone.
| Compound Name | (4-morpholin-4-ylphenyl)-[(3S)-3-phenylazepan-1-yl]methanone |
|---|---|
| PubChem CID | 129355029 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (4-morpholin-4-ylphenyl)-[(3S)-3-phenylazepan-1-yl]methanone |
| SMILES | O=C(c1ccc(N2CCOCC2)cc1)N1CCCC[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C23H28N2O2/c26-23(20-9-11-22(12-10-20)24-14-16-27-17-15-24)25-13-5-4-8-21(18-25)19-6-2-1-3-7-19/h1-3,6-7,9-12,21H,4-5,8,13-18H2/t21-/m1/s1 |
| InChIKey | CQAZDSLWSOZQOJ-OAQYLSRUSA-N |
| XLogP | 3.93 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |