C15H16N2O — CID 47130966
2-[(E)-3-oxo-3-piperidin-1-ylprop-1-enyl]benzonitrile (PubChem CID 47130966) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-[(E)-3-oxo-3-piperidin-1-ylprop-1-enyl]benzonitrile.
| Compound Name | 2-[(E)-3-oxo-3-piperidin-1-ylprop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 47130966 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2-[(E)-3-oxo-3-piperidin-1-ylprop-1-enyl]benzonitrile |
| SMILES | N#Cc1ccccc1/C=C/C(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H16N2O/c16-12-14-7-3-2-6-13(14)8-9-15(18)17-10-4-1-5-11-17/h2-3,6-9H,1,4-5,10-11H2/b9-8+ |
| InChIKey | GJXLYJKHWHMSIN-CMDGGOBGSA-N |
| XLogP | 2.58 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|