C30H32N2O2 — CID 54754331
(E)-3-[10-[(E)-3-oxo-3-piperidin-1-ylprop-1-enyl]anthracen-9-yl]-1-piperidin-1-ylprop-2-en-1-one (PubChem CID 54754331) has the molecular formula C30H32N2O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is (E)-3-[10-[(E)-3-oxo-3-piperidin-1-ylprop-1-enyl]anthracen-9-yl]-1-piperidin-1-ylprop-2-en-1-one.
| Compound Name | (E)-3-[10-[(E)-3-oxo-3-piperidin-1-ylprop-1-enyl]anthracen-9-yl]-1-piperidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 54754331 |
| Molecular Formula | C30H32N2O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | (E)-3-[10-[(E)-3-oxo-3-piperidin-1-ylprop-1-enyl]anthracen-9-yl]-1-piperidin-1-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1c2ccccc2c(/C=C/C(=O)N2CCCCC2)c2ccccc12)N1CCCCC1 |
| InChI | InChI=1S/C30H32N2O2/c33-29(31-19-7-1-8-20-31)17-15-27-23-11-3-5-13-25(23)28(26-14-6-4-12-24(26)27)16-18-30(34)32-21-9-2-10-22-32/h3-6,11-18H,1-2,7-10,19-22H2/b17-15+,18-16+ |
| InChIKey | MNUWDMIRVDRQBC-YTEMWHBBSA-N |
| XLogP | 6.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|