C24H29N3O2 — CID 39487682
(E)-3-naphthalen-1-yl-1-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 39487682) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is (E)-3-naphthalen-1-yl-1-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-naphthalen-1-yl-1-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 39487682 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (E)-3-naphthalen-1-yl-1-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc2ccccc12)N1CCN(CC(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C24H29N3O2/c28-23(12-11-21-9-6-8-20-7-2-3-10-22(20)21)27-17-15-25(16-18-27)19-24(29)26-13-4-1-5-14-26/h2-3,6-12H,1,4-5,13-19H2/b12-11+ |
| InChIKey | ZZURHJORGBSNQV-VAWYXSNFSA-N |
| XLogP | 3.01 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|