C25H24N2O3 — CID 37165794
(E)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-naphthalen-1-ylprop-2-en-1-one (PubChem CID 37165794) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is (E)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-naphthalen-1-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-naphthalen-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 37165794 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (E)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-naphthalen-1-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc2ccccc12)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C25H24N2O3/c28-25(11-9-21-6-3-5-20-4-1-2-7-22(20)21)27-14-12-26(13-15-27)17-19-8-10-23-24(16-19)30-18-29-23/h1-11,16H,12-15,17-18H2/b11-9+ |
| InChIKey | DCHVEXBXYJPHDF-PKNBQFBNSA-N |
| XLogP | 3.93 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|