C22H23FN2O2 — CID 71901749
1-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]-3-(2-fluorophenyl)prop-2-en-1-one (PubChem CID 71901749) has the molecular formula C22H23FN2O2 and a molecular weight of 366.44 g/mol. Its IUPAC name is 1-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]-3-(2-fluorophenyl)prop-2-en-1-one.
| Compound Name | 1-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]-3-(2-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71901749 |
| Molecular Formula | C22H23FN2O2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]-3-(2-fluorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1F)N1CCN(Cc2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C22H23FN2O2/c23-20-4-2-1-3-18(20)6-8-22(26)25-12-10-24(11-13-25)16-17-5-7-21-19(15-17)9-14-27-21/h1-8,15H,9-14,16H2 |
| InChIKey | UTASVNFNFKTYDN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|