C24H25N3O4 — CID 46613288
2-[3-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione (PubChem CID 46613288) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-[3-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 46613288 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-[3-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]-3-oxopropyl]isoindole-1,3-dione |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)N1CCN(Cc2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C24H25N3O4/c28-22(7-9-27-23(29)19-3-1-2-4-20(19)24(27)30)26-12-10-25(11-13-26)16-17-5-6-21-18(15-17)8-14-31-21/h1-6,15H,7-14,16H2 |
| InChIKey | VARGPEWLUWGXFG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|