C24H26N4O4 — CID 30738722
1-benzyl-3-[[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4,5-trione (PubChem CID 30738722) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 1-benzyl-3-[[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-benzyl-3-[[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 30738722 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-benzyl-3-[[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(CN2CCN(Cc3ccc4c(c3)CCO4)CC2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H26N4O4/c29-22-23(30)28(24(31)27(22)16-18-4-2-1-3-5-18)17-26-11-9-25(10-12-26)15-19-6-7-21-20(14-19)8-13-32-21/h1-7,14H,8-13,15-17H2 |
| InChIKey | ZRMHROFOUWHCEC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|