C25H29N3O2S — CID 17455873
5-(1,3-benzothiazol-2-yl)-1-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]pentan-1-one (PubChem CID 17455873) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-1-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-1-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 17455873 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-1-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]pentan-1-one |
| SMILES | O=C(CCCCc1nc2ccccc2s1)N1CCN(Cc2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C25H29N3O2S/c29-25(8-4-3-7-24-26-21-5-1-2-6-23(21)31-24)28-14-12-27(13-15-28)18-19-9-10-22-20(17-19)11-16-30-22/h1-2,5-6,9-10,17H,3-4,7-8,11-16,18H2 |
| InChIKey | FWMXMQRJQGOSGN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|