C22H26N4OS — CID 134045139
5-(1,3-benzothiazol-2-yl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pentan-1-one (PubChem CID 134045139) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 134045139 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pentan-1-one |
| SMILES | O=C(CCCCc1nc2ccccc2s1)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C22H26N4OS/c27-22(10-4-3-9-21-24-19-7-1-2-8-20(19)28-21)26-14-12-25(13-15-26)17-18-6-5-11-23-16-18/h1-2,5-8,11,16H,3-4,9-10,12-15,17H2 |
| InChIKey | JYSQZYRHNSLWFU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|