C21H26Cl2N4OS — CID 120731329
5-(1,3-benzothiazol-2-yl)-1-(2-pyridin-3-ylpiperazin-1-yl)pentan-1-one;dihydrochloride (PubChem CID 120731329) has the molecular formula C21H26Cl2N4OS and a molecular weight of 453.44 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-1-(2-pyridin-3-ylpiperazin-1-yl)pentan-1-one;dihydrochloride.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-1-(2-pyridin-3-ylpiperazin-1-yl)pentan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 120731329 |
| Molecular Formula | C21H26Cl2N4OS |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-1-(2-pyridin-3-ylpiperazin-1-yl)pentan-1-one;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCCCc1nc2ccccc2s1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C21H24N4OS.2ClH/c26-21(25-13-12-23-15-18(25)16-6-5-11-22-14-16)10-4-3-9-20-24-17-7-1-2-8-19(17)27-20;;/h1-2,5-8,11,14,18,23H,3-4,9-10,12-13,15H2;2*1H |
| InChIKey | RHVONMAZCQFYDF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|