C17H27ClN4O3S — CID 120730031
1-(2-pyridin-3-ylpiperazin-1-yl)-4-pyrrolidin-1-ylsulfonylbutan-1-one;hydrochloride (PubChem CID 120730031) has the molecular formula C17H27ClN4O3S and a molecular weight of 402.95 g/mol. Its IUPAC name is 1-(2-pyridin-3-ylpiperazin-1-yl)-4-pyrrolidin-1-ylsulfonylbutan-1-one;hydrochloride.
| Compound Name | 1-(2-pyridin-3-ylpiperazin-1-yl)-4-pyrrolidin-1-ylsulfonylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120730031 |
| Molecular Formula | C17H27ClN4O3S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-(2-pyridin-3-ylpiperazin-1-yl)-4-pyrrolidin-1-ylsulfonylbutan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCCS(=O)(=O)N1CCCC1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C17H26N4O3S.ClH/c22-17(6-4-12-25(23,24)20-9-1-2-10-20)21-11-8-19-14-16(21)15-5-3-7-18-13-15;/h3,5,7,13,16,19H,1-2,4,6,8-12,14H2;1H |
| InChIKey | LFHUOEXSDRHUHK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |