C23H25FN4O2S — CID 37443565
4-[5-(1,3-benzothiazol-2-yl)pentanoyl]-N-(4-fluorophenyl)piperazine-1-carboxamide (PubChem CID 37443565) has the molecular formula C23H25FN4O2S and a molecular weight of 440.54 g/mol. Its IUPAC name is 4-[5-(1,3-benzothiazol-2-yl)pentanoyl]-N-(4-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[5-(1,3-benzothiazol-2-yl)pentanoyl]-N-(4-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 37443565 |
| Molecular Formula | C23H25FN4O2S |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 4-[5-(1,3-benzothiazol-2-yl)pentanoyl]-N-(4-fluorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(CCCCc1nc2ccccc2s1)N1CCN(C(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H25FN4O2S/c24-17-9-11-18(12-10-17)25-23(30)28-15-13-27(14-16-28)22(29)8-4-3-7-21-26-19-5-1-2-6-20(19)31-21/h1-2,5-6,9-12H,3-4,7-8,13-16H2,(H,25,30) |
| InChIKey | CNURGVRVYUWGNO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|