C23H25N3O2S — CID 31363186
5-(1,3-benzothiazol-2-yl)-1-(4-benzoylpiperazin-1-yl)pentan-1-one (PubChem CID 31363186) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-1-(4-benzoylpiperazin-1-yl)pentan-1-one.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-1-(4-benzoylpiperazin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 31363186 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-1-(4-benzoylpiperazin-1-yl)pentan-1-one |
| SMILES | O=C(CCCCc1nc2ccccc2s1)N1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H25N3O2S/c27-22(13-7-6-12-21-24-19-10-4-5-11-20(19)29-21)25-14-16-26(17-15-25)23(28)18-8-2-1-3-9-18/h1-5,8-11H,6-7,12-17H2 |
| InChIKey | FYAXUGVELMKNPP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|