C19H22N4OS2 — CID 34441872
5-(1,3-benzothiazol-2-yl)-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pentan-1-one (PubChem CID 34441872) has the molecular formula C19H22N4OS2 and a molecular weight of 386.55 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pentan-1-one.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 34441872 |
| Molecular Formula | C19H22N4OS2 |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]pentan-1-one |
| SMILES | O=C(CCCCc1nc2ccccc2s1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C19H22N4OS2/c24-18(22-10-12-23(13-11-22)19-20-9-14-25-19)8-4-3-7-17-21-15-5-1-2-6-16(15)26-17/h1-2,5-6,9,14H,3-4,7-8,10-13H2 |
| InChIKey | YEJMOGUNYOJNJO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|