C18H25N3OS — CID 119487769
5-(1,3-benzothiazol-2-yl)-1-[3-(methylamino)piperidin-1-yl]pentan-1-one (PubChem CID 119487769) has the molecular formula C18H25N3OS and a molecular weight of 331.48 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-1-[3-(methylamino)piperidin-1-yl]pentan-1-one.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-1-[3-(methylamino)piperidin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 119487769 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-1-[3-(methylamino)piperidin-1-yl]pentan-1-one |
| SMILES | CNC1CCCN(C(=O)CCCCc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C18H25N3OS/c1-19-14-7-6-12-21(13-14)18(22)11-5-4-10-17-20-15-8-2-3-9-16(15)23-17/h2-3,8-9,14,19H,4-7,10-13H2,1H3 |
| InChIKey | GBIBRIMTRJXDKM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|