C18H22N2O4S — CID 119247998
2-[4-[5-(1,3-benzothiazol-2-yl)pentanoyl]morpholin-2-yl]acetic acid (PubChem CID 119247998) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-[4-[5-(1,3-benzothiazol-2-yl)pentanoyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[5-(1,3-benzothiazol-2-yl)pentanoyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 119247998 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-[4-[5-(1,3-benzothiazol-2-yl)pentanoyl]morpholin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CN(C(=O)CCCCc2nc3ccccc3s2)CCO1 |
| InChI | InChI=1S/C18H22N2O4S/c21-17(20-9-10-24-13(12-20)11-18(22)23)8-4-3-7-16-19-14-5-1-2-6-15(14)25-16/h1-2,5-6,13H,3-4,7-12H2,(H,22,23) |
| InChIKey | WLYXLJOEUNYPJU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|