C17H20N2O4S — CID 119247708
2-[4-[4-(1,3-benzothiazol-2-yl)butanoyl]morpholin-2-yl]acetic acid (PubChem CID 119247708) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-[4-[4-(1,3-benzothiazol-2-yl)butanoyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[4-(1,3-benzothiazol-2-yl)butanoyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 119247708 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-[4-[4-(1,3-benzothiazol-2-yl)butanoyl]morpholin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CN(C(=O)CCCc2nc3ccccc3s2)CCO1 |
| InChI | InChI=1S/C17H20N2O4S/c20-16(19-8-9-23-12(11-19)10-17(21)22)7-3-6-15-18-13-4-1-2-5-14(13)24-15/h1-2,4-5,12H,3,6-11H2,(H,21,22) |
| InChIKey | HSGNBEZNLHVSCH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |