C17H20N2O3S — CID 119365501
(2S)-1-[5-(1,3-benzothiazol-2-yl)pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 119365501) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is (2S)-1-[5-(1,3-benzothiazol-2-yl)pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[5-(1,3-benzothiazol-2-yl)pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119365501 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (2S)-1-[5-(1,3-benzothiazol-2-yl)pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)CCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H20N2O3S/c20-16(19-11-5-7-13(19)17(21)22)10-4-3-9-15-18-12-6-1-2-8-14(12)23-15/h1-2,6,8,13H,3-5,7,9-11H2,(H,21,22)/t13-/m0/s1 |
| InChIKey | NLWVNLGNQJNNKP-ZDUSSCGKSA-N |
| XLogP | 3.08 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|