C19H19FN2OS — CID 9270471
5-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]pentanamide (PubChem CID 9270471) has the molecular formula C19H19FN2OS and a molecular weight of 342.44 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]pentanamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 9270471 |
| Molecular Formula | C19H19FN2OS |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]pentanamide |
| SMILES | O=C(CCCCc1nc2ccccc2s1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H19FN2OS/c20-15-11-9-14(10-12-15)13-21-18(23)7-3-4-8-19-22-16-5-1-2-6-17(16)24-19/h1-2,5-6,9-12H,3-4,7-8,13H2,(H,21,23) |
| InChIKey | FALXZJOKHPYNET-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|