C19H19N3O2S — CID 32636652
3-[[4-(1,3-benzothiazol-2-yl)butanoylamino]methyl]benzamide (PubChem CID 32636652) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 3-[[4-(1,3-benzothiazol-2-yl)butanoylamino]methyl]benzamide.
| Compound Name | 3-[[4-(1,3-benzothiazol-2-yl)butanoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 32636652 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 3-[[4-(1,3-benzothiazol-2-yl)butanoylamino]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CNC(=O)CCCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C19H19N3O2S/c20-19(24)14-6-3-5-13(11-14)12-21-17(23)9-4-10-18-22-15-7-1-2-8-16(15)25-18/h1-3,5-8,11H,4,9-10,12H2,(H2,20,24)(H,21,23) |
| InChIKey | BOGUXUMWYSSYPS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |