C19H20N2O2S — CID 32638446
4-(1,3-benzothiazol-2-yl)-N-[3-(methoxymethyl)phenyl]butanamide (PubChem CID 32638446) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-[3-(methoxymethyl)phenyl]butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-[3-(methoxymethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 32638446 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-[3-(methoxymethyl)phenyl]butanamide |
| SMILES | COCc1cccc(NC(=O)CCCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C19H20N2O2S/c1-23-13-14-6-4-7-15(12-14)20-18(22)10-5-11-19-21-16-8-2-3-9-17(16)24-19/h2-4,6-9,12H,5,10-11,13H2,1H3,(H,20,22) |
| InChIKey | YYSRHJMUMXWMJH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |