C20H20N2O3S — CID 119252157
3-[4-[4-(1,3-benzothiazol-2-yl)butanoylamino]phenyl]propanoic acid (PubChem CID 119252157) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is 3-[4-[4-(1,3-benzothiazol-2-yl)butanoylamino]phenyl]propanoic acid.
| Compound Name | 3-[4-[4-(1,3-benzothiazol-2-yl)butanoylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 119252157 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 3-[4-[4-(1,3-benzothiazol-2-yl)butanoylamino]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(NC(=O)CCCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H20N2O3S/c23-18(21-15-11-8-14(9-12-15)10-13-20(24)25)6-3-7-19-22-16-4-1-2-5-17(16)26-19/h1-2,4-5,8-9,11-12H,3,6-7,10,13H2,(H,21,23)(H,24,25) |
| InChIKey | YXGGUTHBSAWWBD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |