C20H21N3O2S — CID 34544923
4-[4-(1,3-benzothiazol-2-yl)butanoylamino]-N,N-dimethylbenzamide (PubChem CID 34544923) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 4-[4-(1,3-benzothiazol-2-yl)butanoylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-[4-(1,3-benzothiazol-2-yl)butanoylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 34544923 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4-[4-(1,3-benzothiazol-2-yl)butanoylamino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)CCCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c1-23(2)20(25)14-10-12-15(13-11-14)21-18(24)8-5-9-19-22-16-6-3-4-7-17(16)26-19/h3-4,6-7,10-13H,5,8-9H2,1-2H3,(H,21,24) |
| InChIKey | IGUCCNZYZIHASZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |