C22H25N3O3S — CID 55892689
3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]-4-methoxy-N,N-dimethylbenzamide (PubChem CID 55892689) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]-4-methoxy-N,N-dimethylbenzamide.
| Compound Name | 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]-4-methoxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 55892689 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]-4-methoxy-N,N-dimethylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)C)cc1NC(=O)CCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C22H25N3O3S/c1-25(2)22(27)15-12-13-18(28-3)17(14-15)23-20(26)10-6-7-11-21-24-16-8-4-5-9-19(16)29-21/h4-5,8-9,12-14H,6-7,10-11H2,1-3H3,(H,23,26) |
| InChIKey | GXFCOHXOJSUQQJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|